C28H33NO7S2 — CID 164613494
(5S,5aR,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5-(3-pyrrolidin-1-ylpropyldisulfanyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one (PubChem CID 164613494) has the molecular formula C28H33NO7S2 and a molecular weight of 559.71 g/mol. Its IUPAC name is (5S,5aR,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5-(3-pyrrolidin-1-ylpropyldisulfanyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one.
| Compound Name | (5S,5aR,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5-(3-pyrrolidin-1-ylpropyldisulfanyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 164613494 |
| Molecular Formula | C28H33NO7S2 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | (5S,5aR,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5-(3-pyrrolidin-1-ylpropyldisulfanyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](SSCCCN3CCCC3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1O |
| InChI | InChI=1S/C28H33NO7S2/c1-32-22-10-16(11-23(33-2)26(22)30)24-17-12-20-21(36-15-35-20)13-18(17)27(19-14-34-28(31)25(19)24)38-37-9-5-8-29-6-3-4-7-29/h10-13,19,24-25,27,30H,3-9,14-15H2,1-2H3/t19-,24+,25-,27+/m0/s1 |
| InChIKey | XNEYEISTECBCHD-AIXNUKSASA-N |
| XLogP | 4.98 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|