C22H16Br2N4O4S — CID 164614570
3-[[2-[benzyl-(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]-1,3-benzothiazol-6-yl]amino]-3-oxopropanoic acid (PubChem CID 164614570) has the molecular formula C22H16Br2N4O4S and a molecular weight of 592.27 g/mol. Its IUPAC name is 3-[[2-[benzyl-(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]-1,3-benzothiazol-6-yl]amino]-3-oxopropanoic acid.
| Compound Name | 3-[[2-[benzyl-(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]-1,3-benzothiazol-6-yl]amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 164614570 |
| Molecular Formula | C22H16Br2N4O4S |
| Molecular Weight | 592.27 g/mol |
| Exact Mass | 589.93 |
| IUPAC Name | 3-[[2-[benzyl-(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]-1,3-benzothiazol-6-yl]amino]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)Nc1ccc2nc(N(Cc3ccccc3)C(=O)c3cc(Br)c(Br)[nH]3)sc2c1 |
| InChI | InChI=1S/C22H16Br2N4O4S/c23-14-9-16(26-20(14)24)21(32)28(11-12-4-2-1-3-5-12)22-27-15-7-6-13(8-17(15)33-22)25-18(29)10-19(30)31/h1-9,26H,10-11H2,(H,25,29)(H,30,31) |
| InChIKey | OBDSYVGUGDCZOQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.27 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|