C20H29N3O2 — CID 164615488
6-[[[(3R,5S)-3,5-dimethyl-1-adamantyl]-methylamino]methyl]-N-hydroxypyridine-3-carboxamide (PubChem CID 164615488) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 6-[[[(3R,5S)-3,5-dimethyl-1-adamantyl]-methylamino]methyl]-N-hydroxypyridine-3-carboxamide.
| Compound Name | 6-[[[(3R,5S)-3,5-dimethyl-1-adamantyl]-methylamino]methyl]-N-hydroxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 164615488 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 6-[[[(3R,5S)-3,5-dimethyl-1-adamantyl]-methylamino]methyl]-N-hydroxypyridine-3-carboxamide |
| SMILES | CN(Cc1ccc(C(=O)NO)cn1)C12CC3C[C@@](C)(C1)C[C@](C)(C3)C2 |
| InChI | InChI=1S/C20H29N3O2/c1-18-6-14-7-19(2,11-18)13-20(8-14,12-18)23(3)10-16-5-4-15(9-21-16)17(24)22-25/h4-5,9,14,25H,6-8,10-13H2,1-3H3,(H,22,24)/t14?,18-,19+,20? |
| InChIKey | LPAJIUVDHMMEBG-ODNNXGBQSA-N |
| XLogP | 3.38 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|