C22H27BrN2O2 — CID 164615849
3-butyl-1-cyclohexyl-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide (PubChem CID 164615849) has the molecular formula C22H27BrN2O2 and a molecular weight of 431.37 g/mol. Its IUPAC name is 3-butyl-1-cyclohexyl-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide.
| Compound Name | 3-butyl-1-cyclohexyl-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide |
|---|---|
| PubChem CID | 164615849 |
| Molecular Formula | C22H27BrN2O2 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 3-butyl-1-cyclohexyl-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide |
| SMILES | CCCC[n+]1c2c(n(C3CCCCC3)c1C)C(=O)c1ccccc1C2=O.[Br-] |
| InChI | InChI=1S/C22H27N2O2.BrH/c1-3-4-14-23-15(2)24(16-10-6-5-7-11-16)20-19(23)21(25)17-12-8-9-13-18(17)22(20)26;/h8-9,12-13,16H,3-7,10-11,14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | VPOTZJIVFGGKME-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 42.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|