C15H17NO3S2Se — CID 164617241
4-(2-hydroxy-3-phenylsulfanylpropyl)selanylbenzenesulfonamide (PubChem CID 164617241) has the molecular formula C15H17NO3S2Se and a molecular weight of 402.40 g/mol. Its IUPAC name is 4-(2-hydroxy-3-phenylsulfanylpropyl)selanylbenzenesulfonamide.
| Compound Name | 4-(2-hydroxy-3-phenylsulfanylpropyl)selanylbenzenesulfonamide |
|---|---|
| PubChem CID | 164617241 |
| Molecular Formula | C15H17NO3S2Se |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 4-(2-hydroxy-3-phenylsulfanylpropyl)selanylbenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc([Se]CC(O)CSc2ccccc2)cc1 |
| InChI | InChI=1S/C15H17NO3S2Se/c16-21(18,19)14-6-8-15(9-7-14)22-11-12(17)10-20-13-4-2-1-3-5-13/h1-9,12,17H,10-11H2,(H2,16,18,19) |
| InChIKey | MMVOFFDQNAVGDE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|