C17H14N4 — CID 164617261
3-benzylpyrazino[1,2-a]benzimidazol-1-amine (PubChem CID 164617261) has the molecular formula C17H14N4 and a molecular weight of 274.33 g/mol. Its IUPAC name is 3-benzylpyrazino[1,2-a]benzimidazol-1-amine.
| Compound Name | 3-benzylpyrazino[1,2-a]benzimidazol-1-amine |
|---|---|
| PubChem CID | 164617261 |
| Molecular Formula | C17H14N4 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-benzylpyrazino[1,2-a]benzimidazol-1-amine |
| SMILES | Nc1nc(Cc2ccccc2)cn2c1nc1ccccc12 |
| InChI | InChI=1S/C17H14N4/c18-16-17-20-14-8-4-5-9-15(14)21(17)11-13(19-16)10-12-6-2-1-3-7-12/h1-9,11H,10H2,(H2,18,19) |
| InChIKey | NULDMQXOPYHTEN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |