C17H14N4O — CID 52938093
(4-aminoimidazo[1,2-a]quinoxalin-2-yl)-phenylmethanol (PubChem CID 52938093) has the molecular formula C17H14N4O and a molecular weight of 290.33 g/mol. Its IUPAC name is (4-aminoimidazo[1,2-a]quinoxalin-2-yl)-phenylmethanol.
| Compound Name | (4-aminoimidazo[1,2-a]quinoxalin-2-yl)-phenylmethanol |
|---|---|
| PubChem CID | 52938093 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (4-aminoimidazo[1,2-a]quinoxalin-2-yl)-phenylmethanol |
| SMILES | Nc1nc2ccccc2n2cc(C(O)c3ccccc3)nc12 |
| InChI | InChI=1S/C17H14N4O/c18-16-17-20-13(15(22)11-6-2-1-3-7-11)10-21(17)14-9-5-4-8-12(14)19-16/h1-10,15,22H,(H2,18,19) |
| InChIKey | IVAIPNUPTHDRHV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |