C24H30Cl2N6O2 — CID 164618252
4-(cyclopentylamino)-2-[(2,4-dichlorophenyl)methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyrimidine-5-carboxamide (PubChem CID 164618252) has the molecular formula C24H30Cl2N6O2 and a molecular weight of 505.45 g/mol. Its IUPAC name is 4-(cyclopentylamino)-2-[(2,4-dichlorophenyl)methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyrimidine-5-carboxamide.
| Compound Name | 4-(cyclopentylamino)-2-[(2,4-dichlorophenyl)methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 164618252 |
| Molecular Formula | C24H30Cl2N6O2 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 4-(cyclopentylamino)-2-[(2,4-dichlorophenyl)methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyrimidine-5-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1cnc(NCc2ccc(Cl)cc2Cl)nc1NC1CCCC1 |
| InChI | InChI=1S/C24H30Cl2N6O2/c25-17-9-8-16(20(26)13-17)14-28-24-29-15-19(22(31-24)30-18-5-1-2-6-18)23(34)27-10-4-12-32-11-3-7-21(32)33/h8-9,13,15,18H,1-7,10-12,14H2,(H,27,34)(H2,28,29,30,31) |
| InChIKey | RUAVAAXWRAUNAC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|