C49H52N6O6 — CID 164620620
1-(2-phenylethyl)-4-[[(2S,3R,4S,5R,6R)-6-[[1-(2-phenylethyl)triazol-4-yl]methoxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxymethyl]triazole (PubChem CID 164620620) has the molecular formula C49H52N6O6 and a molecular weight of 820.99 g/mol. Its IUPAC name is 1-(2-phenylethyl)-4-[[(2S,3R,4S,5R,6R)-6-[[1-(2-phenylethyl)triazol-4-yl]methoxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxymethyl]triazole.
| Compound Name | 1-(2-phenylethyl)-4-[[(2S,3R,4S,5R,6R)-6-[[1-(2-phenylethyl)triazol-4-yl]methoxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxymethyl]triazole |
|---|---|
| PubChem CID | 164620620 |
| Molecular Formula | C49H52N6O6 |
| Molecular Weight | 820.99 g/mol |
| Exact Mass | 820.39 |
| IUPAC Name | 1-(2-phenylethyl)-4-[[(2S,3R,4S,5R,6R)-6-[[1-(2-phenylethyl)triazol-4-yl]methoxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxymethyl]triazole |
| SMILES | c1ccc(CCn2cc(COC[C@H]3O[C@H](OCc4cn(CCc5ccccc5)nn4)[C@H](OCc4ccccc4)[C@@H](OCc4ccccc4)[C@@H]3OCc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C49H52N6O6/c1-6-16-38(17-7-1)26-28-54-30-43(50-52-54)35-56-37-45-46(57-32-40-20-10-3-11-21-40)47(58-33-41-22-12-4-13-23-41)48(59-34-42-24-14-5-15-25-42)49(61-45)60-36-44-31-55(53-51-44)29-27-39-18-8-2-9-19-39/h1-25,30-31,45-49H,26-29,32-37H2/t45-,46-,47+,48-,49+/m1/s1 |
| InChIKey | QDLBJZNPIGMPMM-AGCKAGJLSA-N |
| XLogP | 7.57 |
| TPSA | 116.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.99 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |