C46H47N3O9 — CID 53321875
(2S)-3-(4-hydroxyphenyl)-2-[4-[[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]triazol-1-yl]propanoic acid (PubChem CID 53321875) has the molecular formula C46H47N3O9 and a molecular weight of 785.89 g/mol. Its IUPAC name is (2S)-3-(4-hydroxyphenyl)-2-[4-[[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]triazol-1-yl]propanoic acid.
| Compound Name | (2S)-3-(4-hydroxyphenyl)-2-[4-[[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]triazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 53321875 |
| Molecular Formula | C46H47N3O9 |
| Molecular Weight | 785.89 g/mol |
| Exact Mass | 785.33 |
| IUPAC Name | (2S)-3-(4-hydroxyphenyl)-2-[4-[[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]triazol-1-yl]propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(O)cc1)n1cc(CO[C@@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)nn1 |
| InChI | InChI=1S/C46H47N3O9/c50-39-23-21-33(22-24-39)25-40(45(51)52)49-26-38(47-48-49)31-57-46-44(56-30-37-19-11-4-12-20-37)43(55-29-36-17-9-3-10-18-36)42(54-28-35-15-7-2-8-16-35)41(58-46)32-53-27-34-13-5-1-6-14-34/h1-24,26,40-44,46,50H,25,27-32H2,(H,51,52)/t40-,41+,42-,43-,44+,46+/m0/s1 |
| InChIKey | SVDUEIPLOOODBA-LWQOTUEFSA-N |
| XLogP | 7.07 |
| TPSA | 143.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.89 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |