C38H38N4O9 — CID 164621440
9-(2-aminoethoxy)-3-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-10H-pyrimido[5,4-b][1,4]benzoxazin-2-one (PubChem CID 164621440) has the molecular formula C38H38N4O9 and a molecular weight of 694.74 g/mol. Its IUPAC name is 9-(2-aminoethoxy)-3-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-10H-pyrimido[5,4-b][1,4]benzoxazin-2-one.
| Compound Name | 9-(2-aminoethoxy)-3-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-10H-pyrimido[5,4-b][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 164621440 |
| Molecular Formula | C38H38N4O9 |
| Molecular Weight | 694.74 g/mol |
| Exact Mass | 694.26 |
| IUPAC Name | 9-(2-aminoethoxy)-3-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-10H-pyrimido[5,4-b][1,4]benzoxazin-2-one |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc4c(nc3=O)Nc3c(OCCN)cccc3O4)[C@H](O)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H38N4O9/c1-46-26-15-11-24(12-16-26)38(23-7-4-3-5-8-23,25-13-17-27(47-2)18-14-25)49-22-31-33(43)34(44)36(51-31)42-21-30-35(41-37(42)45)40-32-28(48-20-19-39)9-6-10-29(32)50-30/h3-18,21,31,33-34,36,43-44H,19-20,22,39H2,1-2H3,(H,40,41,45)/t31-,33-,34-,36-/m1/s1 |
| InChIKey | BZEDJIWTHGVOLN-YDXJMRNDSA-N |
| XLogP | 4.08 |
| TPSA | 168.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.74 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|