C26H30FNO7 — CID 164621983
[(4S)-4-[(3S,3aR,4S,7aR)-4-acetyloxy-3'-(4-fluorophenyl)-6-methyl-2-oxospiro[3a,4,7,7a-tetrahydro-1-benzofuran-3,5'-4H-1,2-oxazole]-5-yl]pentyl] acetate (PubChem CID 164621983) has the molecular formula C26H30FNO7 and a molecular weight of 487.52 g/mol. Its IUPAC name is [(4S)-4-[(3S,3aR,4S,7aR)-4-acetyloxy-3'-(4-fluorophenyl)-6-methyl-2-oxospiro[3a,4,7,7a-tetrahydro-1-benzofuran-3,5'-4H-1,2-oxazole]-5-yl]pentyl] acetate.
| Compound Name | [(4S)-4-[(3S,3aR,4S,7aR)-4-acetyloxy-3'-(4-fluorophenyl)-6-methyl-2-oxospiro[3a,4,7,7a-tetrahydro-1-benzofuran-3,5'-4H-1,2-oxazole]-5-yl]pentyl] acetate |
|---|---|
| PubChem CID | 164621983 |
| Molecular Formula | C26H30FNO7 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | [(4S)-4-[(3S,3aR,4S,7aR)-4-acetyloxy-3'-(4-fluorophenyl)-6-methyl-2-oxospiro[3a,4,7,7a-tetrahydro-1-benzofuran-3,5'-4H-1,2-oxazole]-5-yl]pentyl] acetate |
| SMILES | CC(=O)OCCC[C@H](C)C1=C(C)C[C@H]2OC(=O)[C@]3(CC(c4ccc(F)cc4)=NO3)[C@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H30FNO7/c1-14(6-5-11-32-16(3)29)22-15(2)12-21-23(24(22)33-17(4)30)26(25(31)34-21)13-20(28-35-26)18-7-9-19(27)10-8-18/h7-10,14,21,23-24H,5-6,11-13H2,1-4H3/t14-,21+,23+,24+,26-/m0/s1 |
| InChIKey | YITYKVBDLYGHGK-RAQKNWTQSA-N |
| XLogP | 3.86 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|