C30H39NO7 — CID 10052573
[(3aR,4R,7aR)-5-[(2S)-5-acetyloxypentan-2-yl]-6-methyl-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-4-yl] (2E)-2-butoxyimino-3-phenylpropanoate (PubChem CID 10052573) has the molecular formula C30H39NO7 and a molecular weight of 525.60 g/mol. Its IUPAC name is [(3aR,4R,7aR)-5-[(2S)-5-acetyloxypentan-2-yl]-6-methyl-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-4-yl] (2E)-2-butoxyimino-3-phenylpropanoate.
| Compound Name | [(3aR,4R,7aR)-5-[(2S)-5-acetyloxypentan-2-yl]-6-methyl-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-4-yl] (2E)-2-butoxyimino-3-phenylpropanoate |
|---|---|
| PubChem CID | 10052573 |
| Molecular Formula | C30H39NO7 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | [(3aR,4R,7aR)-5-[(2S)-5-acetyloxypentan-2-yl]-6-methyl-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-4-yl] (2E)-2-butoxyimino-3-phenylpropanoate |
| SMILES | CCCCO/N=C(\CC1=CC=CC=C1)/C(=O)O[C@@H]2[C@H]3[C@@H](CC(=C2[C@@H](C)CCCOC(=O)C)C)OC(=O)C3=C |
| InChI | InChI=1S/C30H39NO7/c1-6-7-16-36-31-24(18-23-13-9-8-10-14-23)30(34)38-28-26(19(2)12-11-15-35-22(5)32)20(3)17-25-27(28)21(4)29(33)37-25/h8-10,13-14,19,25,27-28H,4,6-7,11-12,15-18H2,1-3,5H3/b31-24+/t19-,25+,27+,28-/m0/s1 |
| InChIKey | URFRJUKYNGEONR-WQVLLWEYSA-N |
| XLogP | 5.20 |
| TPSA | 100.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | 931 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|