C14H20N6O2S — CID 164622259
1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-(furan-2-ylmethyl)urea (PubChem CID 164622259) has the molecular formula C14H20N6O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-(furan-2-ylmethyl)urea.
| Compound Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 164622259 |
| Molecular Formula | C14H20N6O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-(furan-2-ylmethyl)urea |
| SMILES | Cc1nc(N)sc1CCC/N=C(\N)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H20N6O2S/c1-9-11(23-13(16)19-9)5-2-6-17-12(15)20-14(21)18-8-10-4-3-7-22-10/h3-4,7H,2,5-6,8H2,1H3,(H2,16,19)(H4,15,17,18,20,21) |
| InChIKey | ZIGCJXOUXGMUOW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|