C16H26O2 — CID 164622803
3-[(5R,7aS)-7a-methyl-4-propyl-1,2,3,5,6,7-hexahydroinden-5-yl]propanoic acid (PubChem CID 164622803) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 3-[(5R,7aS)-7a-methyl-4-propyl-1,2,3,5,6,7-hexahydroinden-5-yl]propanoic acid.
| Compound Name | 3-[(5R,7aS)-7a-methyl-4-propyl-1,2,3,5,6,7-hexahydroinden-5-yl]propanoic acid |
|---|---|
| PubChem CID | 164622803 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 3-[(5R,7aS)-7a-methyl-4-propyl-1,2,3,5,6,7-hexahydroinden-5-yl]propanoic acid |
| SMILES | CCCC1=C2CCC[C@@]2(C)CC[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C16H26O2/c1-3-5-13-12(7-8-15(17)18)9-11-16(2)10-4-6-14(13)16/h12H,3-11H2,1-2H3,(H,17,18)/t12-,16-/m0/s1 |
| InChIKey | CEQGSFZQODQELE-LRDDRELGSA-N |
| XLogP | 4.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|