C30H28N2O7 — CID 164625057
N-(2-aminophenyl)-4-[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenoxy]benzamide (PubChem CID 164625057) has the molecular formula C30H28N2O7 and a molecular weight of 528.56 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenoxy]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenoxy]benzamide |
|---|---|
| PubChem CID | 164625057 |
| Molecular Formula | C30H28N2O7 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | N-(2-aminophenyl)-4-[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenoxy]benzamide |
| SMILES | COc1ccc(C(=O)c2cc(OC)c(OC)c(OC)c2)cc1Oc1ccc(C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C30H28N2O7/c1-35-24-14-11-19(28(33)20-16-26(36-2)29(38-4)27(17-20)37-3)15-25(24)39-21-12-9-18(10-13-21)30(34)32-23-8-6-5-7-22(23)31/h5-17H,31H2,1-4H3,(H,32,34) |
| InChIKey | SRCKXKGWTNZKIT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|