C20H19ClN4O3 — CID 164625280
4-[7-chloro-4-[(3R)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide (PubChem CID 164625280) has the molecular formula C20H19ClN4O3 and a molecular weight of 398.85 g/mol. Its IUPAC name is 4-[7-chloro-4-[(3R)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide.
| Compound Name | 4-[7-chloro-4-[(3R)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 164625280 |
| Molecular Formula | C20H19ClN4O3 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 4-[7-chloro-4-[(3R)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide |
| SMILES | C[C@@H]1COCCN1c1nc(-c2ccc(C(=O)NO)cc2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C20H19ClN4O3/c1-12-11-28-9-8-25(12)19-16-7-6-15(21)10-17(16)22-18(23-19)13-2-4-14(5-3-13)20(26)24-27/h2-7,10,12,27H,8-9,11H2,1H3,(H,24,26)/t12-/m1/s1 |
| InChIKey | MEWOWLRYSDUDAO-GFCCVEGCSA-N |
| XLogP | 3.29 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|