C15H7F6NO3S — CID 164625291
3-[3,5-bis(trifluoromethyl)phenoxy]-1,2-benzothiazole 1,1-dioxide (PubChem CID 164625291) has the molecular formula C15H7F6NO3S and a molecular weight of 395.28 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenoxy]-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenoxy]-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 164625291 |
| Molecular Formula | C15H7F6NO3S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenoxy]-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C15H7F6NO3S/c16-14(17,18)8-5-9(15(19,20)21)7-10(6-8)25-13-11-3-1-2-4-12(11)26(23,24)22-13/h1-7H |
| InChIKey | BMCDVLZEQAJWSK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |