C25H23N3O3 — CID 164625387
3-(1-methylindol-5-yl)-5-(3,4,5-trimethoxyphenyl)-1H-indazole (PubChem CID 164625387) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 3-(1-methylindol-5-yl)-5-(3,4,5-trimethoxyphenyl)-1H-indazole.
| Compound Name | 3-(1-methylindol-5-yl)-5-(3,4,5-trimethoxyphenyl)-1H-indazole |
|---|---|
| PubChem CID | 164625387 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 3-(1-methylindol-5-yl)-5-(3,4,5-trimethoxyphenyl)-1H-indazole |
| SMILES | COc1cc(-c2ccc3[nH]nc(-c4ccc5c(ccn5C)c4)c3c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H23N3O3/c1-28-10-9-16-11-17(6-8-21(16)28)24-19-12-15(5-7-20(19)26-27-24)18-13-22(29-2)25(31-4)23(14-18)30-3/h5-14H,1-4H3,(H,26,27) |
| InChIKey | WVFLTLGTNSENBP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |