C22H24N4O4 — CID 164625597
4-(5,7-dimethoxy-4-piperidin-1-ylquinazolin-2-yl)-N-hydroxybenzamide (PubChem CID 164625597) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-(5,7-dimethoxy-4-piperidin-1-ylquinazolin-2-yl)-N-hydroxybenzamide.
| Compound Name | 4-(5,7-dimethoxy-4-piperidin-1-ylquinazolin-2-yl)-N-hydroxybenzamide |
|---|---|
| PubChem CID | 164625597 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 4-(5,7-dimethoxy-4-piperidin-1-ylquinazolin-2-yl)-N-hydroxybenzamide |
| SMILES | COc1cc(OC)c2c(N3CCCCC3)nc(-c3ccc(C(=O)NO)cc3)nc2c1 |
| InChI | InChI=1S/C22H24N4O4/c1-29-16-12-17-19(18(13-16)30-2)21(26-10-4-3-5-11-26)24-20(23-17)14-6-8-15(9-7-14)22(27)25-28/h6-9,12-13,28H,3-5,10-11H2,1-2H3,(H,25,27) |
| InChIKey | FKADMRJFBWFFGD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|