C18H12BrN3O3 — CID 164626054
3-[[4-(4-bromo-2-methoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]benzonitrile (PubChem CID 164626054) has the molecular formula C18H12BrN3O3 and a molecular weight of 398.22 g/mol. Its IUPAC name is 3-[[4-(4-bromo-2-methoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]benzonitrile.
| Compound Name | 3-[[4-(4-bromo-2-methoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 164626054 |
| Molecular Formula | C18H12BrN3O3 |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | 3-[[4-(4-bromo-2-methoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]benzonitrile |
| SMILES | COc1cc(Br)ccc1C1=C(Nc2cccc(C#N)c2)C(=O)NC1=O |
| InChI | InChI=1S/C18H12BrN3O3/c1-25-14-8-11(19)5-6-13(14)15-16(18(24)22-17(15)23)21-12-4-2-3-10(7-12)9-20/h2-8H,1H3,(H2,21,22,23,24) |
| InChIKey | NYZXUVGUIAUXBT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|