C16H12N6O2S2 — CID 164627196
2-[3-[[5-(2-hydroxyphenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazol-5-yl]phenol (PubChem CID 164627196) has the molecular formula C16H12N6O2S2 and a molecular weight of 384.45 g/mol. Its IUPAC name is 2-[3-[[5-(2-hydroxyphenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazol-5-yl]phenol.
| Compound Name | 2-[3-[[5-(2-hydroxyphenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazol-5-yl]phenol |
|---|---|
| PubChem CID | 164627196 |
| Molecular Formula | C16H12N6O2S2 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 2-[3-[[5-(2-hydroxyphenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazol-5-yl]phenol |
| SMILES | Oc1ccccc1-c1nc(SSc2n[nH]c(-c3ccccc3O)n2)n[nH]1 |
| InChI | InChI=1S/C16H12N6O2S2/c23-11-7-3-1-5-9(11)13-17-15(21-19-13)25-26-16-18-14(20-22-16)10-6-2-4-8-12(10)24/h1-8,23-24H,(H,17,19,21)(H,18,20,22) |
| InChIKey | FGAZZGALXLSIPA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|