C24H32N6O2 — CID 164629040
1-cyclopentyl-7-(4-piperazin-1-ylanilino)-4-propan-2-yl-4H-pyrimido[4,5-d][1,3]oxazin-2-one (PubChem CID 164629040) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 1-cyclopentyl-7-(4-piperazin-1-ylanilino)-4-propan-2-yl-4H-pyrimido[4,5-d][1,3]oxazin-2-one.
| Compound Name | 1-cyclopentyl-7-(4-piperazin-1-ylanilino)-4-propan-2-yl-4H-pyrimido[4,5-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 164629040 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 1-cyclopentyl-7-(4-piperazin-1-ylanilino)-4-propan-2-yl-4H-pyrimido[4,5-d][1,3]oxazin-2-one |
| SMILES | CC(C)C1OC(=O)N(C2CCCC2)c2nc(Nc3ccc(N4CCNCC4)cc3)ncc21 |
| InChI | InChI=1S/C24H32N6O2/c1-16(2)21-20-15-26-23(28-22(20)30(24(31)32-21)19-5-3-4-6-19)27-17-7-9-18(10-8-17)29-13-11-25-12-14-29/h7-10,15-16,19,21,25H,3-6,11-14H2,1-2H3,(H,26,27,28) |
| InChIKey | WUQMATMEVQEOIT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|