C18H19F2N3O3S — CID 164630245
(3S)-3-fluoro-1-(2-fluorophenyl)sulfonyl-N-(pyridin-4-ylmethyl)piperidine-3-carboxamide (PubChem CID 164630245) has the molecular formula C18H19F2N3O3S and a molecular weight of 395.43 g/mol. Its IUPAC name is (3S)-3-fluoro-1-(2-fluorophenyl)sulfonyl-N-(pyridin-4-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-3-fluoro-1-(2-fluorophenyl)sulfonyl-N-(pyridin-4-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 164630245 |
| Molecular Formula | C18H19F2N3O3S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (3S)-3-fluoro-1-(2-fluorophenyl)sulfonyl-N-(pyridin-4-ylmethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccncc1)[C@]1(F)CCCN(S(=O)(=O)c2ccccc2F)C1 |
| InChI | InChI=1S/C18H19F2N3O3S/c19-15-4-1-2-5-16(15)27(25,26)23-11-3-8-18(20,13-23)17(24)22-12-14-6-9-21-10-7-14/h1-2,4-7,9-10H,3,8,11-13H2,(H,22,24)/t18-/m0/s1 |
| InChIKey | XKHYBPGVEBHWLU-SFHVURJKSA-N |
| XLogP | 2.03 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |