About N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide
N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide (PubChem CID 164633307) has the molecular formula C13H18F2N2O2S
and a molecular weight of 304.36 g/mol. Its IUPAC name is N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide |
| PubChem CID | 164633307 |
| Molecular Formula | C13H18F2N2O2S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide |
| SMILES | CCO[C@@H](C)c1ncc(C(=O)NCC2CC(F)(F)C2)s1 |
| InChI | InChI=1S/C13H18F2N2O2S/c1-3-19-8(2)12-17-7-10(20-12)11(18)16-6-9-4-13(14,15)5-9/h7-9H,3-6H2,1-2H3,(H,16,18)/t8-/m0/s1 |
| InChIKey | BKFNLWOMWZVTGN-QMMMGPOBSA-N |
| XLogP | 3.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide?
The IUPAC name of N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide (CID 164633307) is N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide is CCO[C@@H](C)c1ncc(C(=O)NCC2CC(F)(F)C2)s1.
What is the InChIKey of N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide?
The InChIKey is BKFNLWOMWZVTGN-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H18F2N2O2S/c1-3-19-8(2)12-17-7-10(20-12)11(18)16-6-9-4-13(14,15)5-9/h7-9H,3-6H2,1-2H3,(H,16,18)/t8-/m0/s1.
What are the key properties of N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide?
N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide has a molecular weight of 304.36 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-difluorocyclobutyl)methyl]-2-[(1S)-1-ethoxyethyl]-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 164633307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).