About N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide
N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide (PubChem CID 126767362) has the molecular formula C9H10F2N2O2
and a molecular weight of 216.19 g/mol. Its IUPAC name is N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide |
| PubChem CID | 126767362 |
| Molecular Formula | C9H10F2N2O2 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCC1CC(F)(F)C1)c1ccon1 |
| InChI | InChI=1S/C9H10F2N2O2/c10-9(11)3-6(4-9)5-12-8(14)7-1-2-15-13-7/h1-2,6H,3-5H2,(H,12,14) |
| InChIKey | DMXIJLAQIPXXLZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide?
The IUPAC name of N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide (CID 126767362) is N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide is O=C(NCC1CC(F)(F)C1)c1ccon1.
What is the InChIKey of N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide?
The InChIKey is DMXIJLAQIPXXLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N2O2/c10-9(11)3-6(4-9)5-12-8(14)7-1-2-15-13-7/h1-2,6H,3-5H2,(H,12,14).
What are the key properties of N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide?
N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide has a molecular weight of 216.19 g/mol, XLogP of 1.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-difluorocyclobutyl)methyl]-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 126767362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).