C12H18ClNO3S2 — CID 164637014
3-chloro-N-ethyl-4-methyl-N-[(2S)-1-methylsulfonylpropan-2-yl]thiophene-2-carboxamide (PubChem CID 164637014) has the molecular formula C12H18ClNO3S2 and a molecular weight of 323.87 g/mol. Its IUPAC name is 3-chloro-N-ethyl-4-methyl-N-[(2S)-1-methylsulfonylpropan-2-yl]thiophene-2-carboxamide.
| Compound Name | 3-chloro-N-ethyl-4-methyl-N-[(2S)-1-methylsulfonylpropan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 164637014 |
| Molecular Formula | C12H18ClNO3S2 |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 3-chloro-N-ethyl-4-methyl-N-[(2S)-1-methylsulfonylpropan-2-yl]thiophene-2-carboxamide |
| SMILES | CCN(C(=O)c1scc(C)c1Cl)[C@@H](C)CS(C)(=O)=O |
| InChI | InChI=1S/C12H18ClNO3S2/c1-5-14(9(3)7-19(4,16)17)12(15)11-10(13)8(2)6-18-11/h6,9H,5,7H2,1-4H3/t9-/m0/s1 |
| InChIKey | ROKMLFHLIFHELX-VIFPVBQESA-N |
| XLogP | 2.61 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |