C15H19N5O2 — CID 164641046
(5S)-3,5-dimethyl-N-(2-pyridin-3-ylethyl)-6,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazine-5-carboxamide (PubChem CID 164641046) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is (5S)-3,5-dimethyl-N-(2-pyridin-3-ylethyl)-6,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazine-5-carboxamide.
| Compound Name | (5S)-3,5-dimethyl-N-(2-pyridin-3-ylethyl)-6,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazine-5-carboxamide |
|---|---|
| PubChem CID | 164641046 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (5S)-3,5-dimethyl-N-(2-pyridin-3-ylethyl)-6,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazine-5-carboxamide |
| SMILES | Cc1nnc2n1[C@](C)(C(=O)NCCc1cccnc1)COC2 |
| InChI | InChI=1S/C15H19N5O2/c1-11-18-19-13-9-22-10-15(2,20(11)13)14(21)17-7-5-12-4-3-6-16-8-12/h3-4,6,8H,5,7,9-10H2,1-2H3,(H,17,21)/t15-/m0/s1 |
| InChIKey | UOBVKXUAQVSKJR-HNNXBMFYSA-N |
| XLogP | 0.59 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |