C9H13ClN2OS — CID 164644414
2-chloro-N-(ethylsulfonimidoyl)-6-methylaniline (PubChem CID 164644414) has the molecular formula C9H13ClN2OS and a molecular weight of 232.74 g/mol. Its IUPAC name is 2-chloro-N-(ethylsulfonimidoyl)-6-methylaniline.
| Compound Name | 2-chloro-N-(ethylsulfonimidoyl)-6-methylaniline |
|---|---|
| PubChem CID | 164644414 |
| Molecular Formula | C9H13ClN2OS |
| Molecular Weight | 232.74 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 2-chloro-N-(ethylsulfonimidoyl)-6-methylaniline |
| SMILES | [H]N=S(=O)(CC)Nc1c(C)cccc1Cl |
| InChI | InChI=1S/C9H13ClN2OS/c1-3-14(11,13)12-9-7(2)5-4-6-8(9)10/h4-6H,3H2,1-2H3,(H2,11,12,13) |
| InChIKey | NLBLSTSEAXTVGV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.74 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |