C9H13FN2OS — CID 164657353
N-(ethylsulfonimidoyl)-2-fluoro-6-methylaniline (PubChem CID 164657353) has the molecular formula C9H13FN2OS and a molecular weight of 216.28 g/mol. Its IUPAC name is N-(ethylsulfonimidoyl)-2-fluoro-6-methylaniline.
| Compound Name | N-(ethylsulfonimidoyl)-2-fluoro-6-methylaniline |
|---|---|
| PubChem CID | 164657353 |
| Molecular Formula | C9H13FN2OS |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | N-(ethylsulfonimidoyl)-2-fluoro-6-methylaniline |
| SMILES | [H]N=S(=O)(CC)Nc1c(C)cccc1F |
| InChI | InChI=1S/C9H13FN2OS/c1-3-14(11,13)12-9-7(2)5-4-6-8(9)10/h4-6H,3H2,1-2H3,(H2,11,12,13) |
| InChIKey | PMPVBTGFLRQWQX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |