C11H17NOS — CID 164646031
N,5-dimethyl-5-(thiophen-3-ylmethyl)oxolan-3-amine (PubChem CID 164646031) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is N,5-dimethyl-5-(thiophen-3-ylmethyl)oxolan-3-amine.
| Compound Name | N,5-dimethyl-5-(thiophen-3-ylmethyl)oxolan-3-amine |
|---|---|
| PubChem CID | 164646031 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N,5-dimethyl-5-(thiophen-3-ylmethyl)oxolan-3-amine |
| SMILES | CNC1COC(C)(Cc2ccsc2)C1 |
| InChI | InChI=1S/C11H17NOS/c1-11(5-9-3-4-14-8-9)6-10(12-2)7-13-11/h3-4,8,10,12H,5-7H2,1-2H3 |
| InChIKey | LCUWACJMGUZABR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |