C11H13ClIN — CID 164646221
5-chloro-8-iodo-4,4-dimethyl-2,3-dihydro-1H-quinoline (PubChem CID 164646221) has the molecular formula C11H13ClIN and a molecular weight of 321.59 g/mol. Its IUPAC name is 5-chloro-8-iodo-4,4-dimethyl-2,3-dihydro-1H-quinoline.
| Compound Name | 5-chloro-8-iodo-4,4-dimethyl-2,3-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 164646221 |
| Molecular Formula | C11H13ClIN |
| Molecular Weight | 321.59 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | 5-chloro-8-iodo-4,4-dimethyl-2,3-dihydro-1H-quinoline |
| SMILES | CC1(C)CCNc2c(I)ccc(Cl)c21 |
| InChI | InChI=1S/C11H13ClIN/c1-11(2)5-6-14-10-8(13)4-3-7(12)9(10)11/h3-4,14H,5-6H2,1-2H3 |
| InChIKey | SAASPTOPGWQLQU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|