C11H13Cl2NO — CID 104523654
6,9-dichloro-2,2-dimethyl-4,5-dihydro-3H-1,5-benzoxazepine (PubChem CID 104523654) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is 6,9-dichloro-2,2-dimethyl-4,5-dihydro-3H-1,5-benzoxazepine.
| Compound Name | 6,9-dichloro-2,2-dimethyl-4,5-dihydro-3H-1,5-benzoxazepine |
|---|---|
| PubChem CID | 104523654 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 6,9-dichloro-2,2-dimethyl-4,5-dihydro-3H-1,5-benzoxazepine |
| SMILES | CC1(C)CCNc2c(Cl)ccc(Cl)c2O1 |
| InChI | InChI=1S/C11H13Cl2NO/c1-11(2)5-6-14-9-7(12)3-4-8(13)10(9)15-11/h3-4,14H,5-6H2,1-2H3 |
| InChIKey | LKYBBEMQEPBPHU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |