C11H16N2OS — CID 164647354
(1-amino-3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanone (PubChem CID 164647354) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is (1-amino-3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanone.
| Compound Name | (1-amino-3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 164647354 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (1-amino-3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanone |
| SMILES | CC1CCCC(N)(C(=O)c2cnsc2)C1 |
| InChI | InChI=1S/C11H16N2OS/c1-8-3-2-4-11(12,5-8)10(14)9-6-13-15-7-9/h6-8H,2-5,12H2,1H3 |
| InChIKey | KBDOHPINHQGVPQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |