C8H15N3OS — CID 164647864
2-(thiolan-3-ylamino)-1,4,5,6-tetrahydropyrimidin-5-ol (PubChem CID 164647864) has the molecular formula C8H15N3OS and a molecular weight of 201.29 g/mol. Its IUPAC name is 2-(thiolan-3-ylamino)-1,4,5,6-tetrahydropyrimidin-5-ol.
| Compound Name | 2-(thiolan-3-ylamino)-1,4,5,6-tetrahydropyrimidin-5-ol |
|---|---|
| PubChem CID | 164647864 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-(thiolan-3-ylamino)-1,4,5,6-tetrahydropyrimidin-5-ol |
| SMILES | OC1CN=C(NC2CCSC2)NC1 |
| InChI | InChI=1S/C8H15N3OS/c12-7-3-9-8(10-4-7)11-6-1-2-13-5-6/h6-7,12H,1-5H2,(H2,9,10,11) |
| InChIKey | QOHUEHSJGMPVHW-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |