About 5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine
5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine (PubChem CID 164649735) has the molecular formula C11H22ClN
and a molecular weight of 203.76 g/mol. Its IUPAC name is 5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine |
| PubChem CID | 164649735 |
| Molecular Formula | C11H22ClN |
| Molecular Weight | 203.76 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine |
| SMILES | CC(C)NC1CC(Cl)CC(C)(C)C1 |
| InChI | InChI=1S/C11H22ClN/c1-8(2)13-10-5-9(12)6-11(3,4)7-10/h8-10,13H,5-7H2,1-4H3 |
| InChIKey | LYDLGACXNQKPNC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.76 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine?
The IUPAC name of 5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine (CID 164649735) is 5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine.
What is the SMILES notation for 5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine?
The canonical SMILES for 5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine is CC(C)NC1CC(Cl)CC(C)(C)C1.
What is the InChIKey of 5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine?
The InChIKey is LYDLGACXNQKPNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22ClN/c1-8(2)13-10-5-9(12)6-11(3,4)7-10/h8-10,13H,5-7H2,1-4H3.
What are the key properties of 5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine?
5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine has a molecular weight of 203.76 g/mol, XLogP of 3.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3,3-dimethyl-N-propan-2-ylcyclohexan-1-amine is sourced from PubChem (CID 164649735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).