C11H19NO2 — CID 164651652
2-(7-hydroxy-8,8-dimethyl-2-azabicyclo[4.2.0]octan-2-yl)acetaldehyde (PubChem CID 164651652) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-(7-hydroxy-8,8-dimethyl-2-azabicyclo[4.2.0]octan-2-yl)acetaldehyde.
| Compound Name | 2-(7-hydroxy-8,8-dimethyl-2-azabicyclo[4.2.0]octan-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 164651652 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-(7-hydroxy-8,8-dimethyl-2-azabicyclo[4.2.0]octan-2-yl)acetaldehyde |
| SMILES | CC1(C)C(O)C2CCCN(CC=O)C21 |
| InChI | InChI=1S/C11H19NO2/c1-11(2)9-8(10(11)14)4-3-5-12(9)6-7-13/h7-10,14H,3-6H2,1-2H3 |
| InChIKey | YIYMUGYXEANPCG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|