C8H10F2N2O2 — CID 164651877
1-(3,3-difluorocyclobutyl)-1,3-diazinane-2,4-dione (PubChem CID 164651877) has the molecular formula C8H10F2N2O2 and a molecular weight of 204.18 g/mol. Its IUPAC name is 1-(3,3-difluorocyclobutyl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(3,3-difluorocyclobutyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 164651877 |
| Molecular Formula | C8H10F2N2O2 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 1-(3,3-difluorocyclobutyl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(C2CC(F)(F)C2)C(=O)N1 |
| InChI | InChI=1S/C8H10F2N2O2/c9-8(10)3-5(4-8)12-2-1-6(13)11-7(12)14/h5H,1-4H2,(H,11,13,14) |
| InChIKey | HBPHIWSRSYLOPZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |