C7H9FIN3 — CID 164652119
1-(4-fluoro-5-iodopyrimidin-2-yl)-N,N-dimethylmethanamine (PubChem CID 164652119) has the molecular formula C7H9FIN3 and a molecular weight of 281.07 g/mol. Its IUPAC name is 1-(4-fluoro-5-iodopyrimidin-2-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(4-fluoro-5-iodopyrimidin-2-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 164652119 |
| Molecular Formula | C7H9FIN3 |
| Molecular Weight | 281.07 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | 1-(4-fluoro-5-iodopyrimidin-2-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ncc(I)c(F)n1 |
| InChI | InChI=1S/C7H9FIN3/c1-12(2)4-6-10-3-5(9)7(8)11-6/h3H,4H2,1-2H3 |
| InChIKey | IJZILFDPMQBECS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.07 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|