C11H6ClF2IN2 — CID 66294711
4-chloro-2-[(2,4-difluorophenyl)methyl]-5-iodopyrimidine (PubChem CID 66294711) has the molecular formula C11H6ClF2IN2 and a molecular weight of 366.54 g/mol. Its IUPAC name is 4-chloro-2-[(2,4-difluorophenyl)methyl]-5-iodopyrimidine.
| Compound Name | 4-chloro-2-[(2,4-difluorophenyl)methyl]-5-iodopyrimidine |
|---|---|
| PubChem CID | 66294711 |
| Molecular Formula | C11H6ClF2IN2 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 365.92 |
| IUPAC Name | 4-chloro-2-[(2,4-difluorophenyl)methyl]-5-iodopyrimidine |
| SMILES | Fc1ccc(Cc2ncc(I)c(Cl)n2)c(F)c1 |
| InChI | InChI=1S/C11H6ClF2IN2/c12-11-9(15)5-16-10(17-11)3-6-1-2-7(13)4-8(6)14/h1-2,4-5H,3H2 |
| InChIKey | JDSDSPAVZNPOEF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|