C9H7F2N3S — CID 64560024
3-[(2,4-difluorophenyl)methyl]-1,2,4-thiadiazol-5-amine (PubChem CID 64560024) has the molecular formula C9H7F2N3S and a molecular weight of 227.24 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 64560024 |
| Molecular Formula | C9H7F2N3S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(Cc2ccc(F)cc2F)ns1 |
| InChI | InChI=1S/C9H7F2N3S/c10-6-2-1-5(7(11)4-6)3-8-13-9(12)15-14-8/h1-2,4H,3H2,(H2,12,13,14) |
| InChIKey | YSUPWJLXNRFWDI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |