C11H8F2N2OS2 — CID 174874736
N-[3-[(2,4-difluorophenyl)methyl]-1,2-thiazol-5-yl]-N-sulfanylformamide (PubChem CID 174874736) has the molecular formula C11H8F2N2OS2 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[3-[(2,4-difluorophenyl)methyl]-1,2-thiazol-5-yl]-N-sulfanylformamide.
| Compound Name | N-[3-[(2,4-difluorophenyl)methyl]-1,2-thiazol-5-yl]-N-sulfanylformamide |
|---|---|
| PubChem CID | 174874736 |
| Molecular Formula | C11H8F2N2OS2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | N-[3-[(2,4-difluorophenyl)methyl]-1,2-thiazol-5-yl]-N-sulfanylformamide |
| SMILES | O=CN(S)c1cc(Cc2ccc(F)cc2F)ns1 |
| InChI | InChI=1S/C11H8F2N2OS2/c12-8-2-1-7(10(13)4-8)3-9-5-11(18-14-9)15(17)6-16/h1-2,4-6,17H,3H2 |
| InChIKey | RJUJZXXVBOXGAG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 33.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|