C12H8F2OS — CID 131497573
3-[(2,4-difluorophenyl)methyl]thiophene-2-carbaldehyde (PubChem CID 131497573) has the molecular formula C12H8F2OS and a molecular weight of 238.26 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]thiophene-2-carbaldehyde.
| Compound Name | 3-[(2,4-difluorophenyl)methyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 131497573 |
| Molecular Formula | C12H8F2OS |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1sccc1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C12H8F2OS/c13-10-2-1-8(11(14)6-10)5-9-3-4-16-12(9)7-15/h1-4,6-7H,5H2 |
| InChIKey | HIJBHKFRXLCNBY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|