C11H18N2O — CID 164652443
(5-amino-2-azabicyclo[2.1.1]hexan-2-yl)-(3-methylcyclobutyl)methanone (PubChem CID 164652443) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (5-amino-2-azabicyclo[2.1.1]hexan-2-yl)-(3-methylcyclobutyl)methanone.
| Compound Name | (5-amino-2-azabicyclo[2.1.1]hexan-2-yl)-(3-methylcyclobutyl)methanone |
|---|---|
| PubChem CID | 164652443 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (5-amino-2-azabicyclo[2.1.1]hexan-2-yl)-(3-methylcyclobutyl)methanone |
| SMILES | CC1CC(C(=O)N2CC3CC2C3N)C1 |
| InChI | InChI=1S/C11H18N2O/c1-6-2-7(3-6)11(14)13-5-8-4-9(13)10(8)12/h6-10H,2-5,12H2,1H3 |
| InChIKey | YKOJXPRNPXJORJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |