C8H8ClN5O — CID 164653443
N-(2-chloroethyl)-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide (PubChem CID 164653443) has the molecular formula C8H8ClN5O and a molecular weight of 225.64 g/mol. Its IUPAC name is N-(2-chloroethyl)-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide.
| Compound Name | N-(2-chloroethyl)-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 164653443 |
| Molecular Formula | C8H8ClN5O |
| Molecular Weight | 225.64 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | N-(2-chloroethyl)-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide |
| SMILES | O=C(NCCCl)c1cn2cnnc2cn1 |
| InChI | InChI=1S/C8H8ClN5O/c9-1-2-10-8(15)6-4-14-5-12-13-7(14)3-11-6/h3-5H,1-2H2,(H,10,15) |
| InChIKey | LXZIFFVGJJZNRM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.64 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|