5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid

C6H5N5O2S — CID 164653809

IUPAC5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid
SMILESCn1nnc(-c2scnc2C(=O)O)n1
InChIInChI=1S/C6H5N5O2S/c1-11-9-5(8-10-11)4-3(6(12)13)7-2-14-4/h2H,1H3,(H,12,13)
InChIKeyTVTDZNVDDKZWGC-UHFFFAOYSA-N
MW211.21 g/mol
LogP0.03
Rot. Bonds2

About 5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid

5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 164653809) has the molecular formula C6H5N5O2S and a molecular weight of 211.21 g/mol. Its IUPAC name is 5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid
PubChem CID164653809
Molecular FormulaC6H5N5O2S
Molecular Weight211.21 g/mol
Exact Mass211.02
IUPAC Name5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid
SMILESCn1nnc(-c2scnc2C(=O)O)n1
InChIInChI=1S/C6H5N5O2S/c1-11-9-5(8-10-11)4-3(6(12)13)7-2-14-4/h2H,1H3,(H,12,13)
InChIKeyTVTDZNVDDKZWGC-UHFFFAOYSA-N
XLogP0.03
TPSA93.79 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.21
LogP ≤ 50.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze 5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid (CID 164653809) is 5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid is Cn1nnc(-c2scnc2C(=O)O)n1.
What is the InChIKey of 5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is TVTDZNVDDKZWGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5O2S/c1-11-9-5(8-10-11)4-3(6(12)13)7-2-14-4/h2H,1H3,(H,12,13).
What are the key properties of 5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid?
5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 211.21 g/mol, XLogP of 0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyltetrazol-5-yl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 164653809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).