C8H7Cl2N5 — CID 164655760
2,4-dichloro-6-(4-ethylpyrazol-1-yl)-1,3,5-triazine (PubChem CID 164655760) has the molecular formula C8H7Cl2N5 and a molecular weight of 244.09 g/mol. Its IUPAC name is 2,4-dichloro-6-(4-ethylpyrazol-1-yl)-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-(4-ethylpyrazol-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 164655760 |
| Molecular Formula | C8H7Cl2N5 |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 2,4-dichloro-6-(4-ethylpyrazol-1-yl)-1,3,5-triazine |
| SMILES | CCc1cnn(-c2nc(Cl)nc(Cl)n2)c1 |
| InChI | InChI=1S/C8H7Cl2N5/c1-2-5-3-11-15(4-5)8-13-6(9)12-7(10)14-8/h3-4H,2H2,1H3 |
| InChIKey | XXRXIURAOCKXNW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |