C10H15F3N2O — CID 164655788
1-[(3aS,6aR)-3a-(aminomethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2,2,2-trifluoroethanone (PubChem CID 164655788) has the molecular formula C10H15F3N2O and a molecular weight of 236.24 g/mol. Its IUPAC name is 1-[(3aS,6aR)-3a-(aminomethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(3aS,6aR)-3a-(aminomethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 164655788 |
| Molecular Formula | C10H15F3N2O |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 1-[(3aS,6aR)-3a-(aminomethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-2,2,2-trifluoroethanone |
| SMILES | NC[C@]12CCC[C@H]1CN(C(=O)C(F)(F)F)C2 |
| InChI | InChI=1S/C10H15F3N2O/c11-10(12,13)8(16)15-4-7-2-1-3-9(7,5-14)6-15/h7H,1-6,14H2/t7-,9-/m0/s1 |
| InChIKey | FVMNBSUCSFKYOS-CBAPKCEASA-N |
| XLogP | 1.14 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |