C11H14ClNS — CID 164656098
2-(2-chloro-4-methylphenyl)-4-methyl-1,3-thiazolidine (PubChem CID 164656098) has the molecular formula C11H14ClNS and a molecular weight of 227.76 g/mol. Its IUPAC name is 2-(2-chloro-4-methylphenyl)-4-methyl-1,3-thiazolidine.
| Compound Name | 2-(2-chloro-4-methylphenyl)-4-methyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 164656098 |
| Molecular Formula | C11H14ClNS |
| Molecular Weight | 227.76 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-(2-chloro-4-methylphenyl)-4-methyl-1,3-thiazolidine |
| SMILES | Cc1ccc(C2NC(C)CS2)c(Cl)c1 |
| InChI | InChI=1S/C11H14ClNS/c1-7-3-4-9(10(12)5-7)11-13-8(2)6-14-11/h3-5,8,11,13H,6H2,1-2H3 |
| InChIKey | FEWSMQPGQZUZOB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.76 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |