C13H15ClN2O — CID 164656251
N-benzyl-5-chloro-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 164656251) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is N-benzyl-5-chloro-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-benzyl-5-chloro-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 164656251 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | N-benzyl-5-chloro-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCC=C(Cl)C1 |
| InChI | InChI=1S/C13H15ClN2O/c14-12-7-4-8-16(10-12)13(17)15-9-11-5-2-1-3-6-11/h1-3,5-7H,4,8-10H2,(H,15,17) |
| InChIKey | NXJCEOZGRPYGLE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |